* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 2330998 |
English Synonyms: | ZERENEX E/6026541 ; EMOLECULES 2330998 |
MDL Number.: | MFCD00411960 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc2cc(ccc2c1)/C=N/NC(=O)c3ccncc3 |
InChi: | InChI=1S/C17H13N3O/c21-17(15-7-9-18-10-8-15)20-19-12-13-5-6-14-3-1-2-4-16(14)11-13/h1-12H,(H,20,21)/b19-12+ |
InChiKey: | InChIKey=MPYMKWZRJNZVNU-XDHOZWIPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.