Molecular Structure:
CCD No.:CCD00128023
ZERENEX E/1120092
Formula:C12 H16 N4 O5
MolWeight:296.281
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/1120092 |
| English Synonyms： | ZERENEX E/1120092 |
| MDL Number.： | MFCD00412459 |
| H bond acceptor： | 9 |
| H bond donor： | 1 |
| Smile： | c1cc(c(cc1[N+](=O)[O-])[N+](=O)[O-])N2CCN(CC2)CCO |
| InChi： | InChI=1S/C12H16N4O5/c17-8-7-13-3-5-14(6-4-13)11-2-1-10(15(18)19)9-12(11)16(20)21/h1-2,9,17H,3-8H2 |
| InChiKey： | InChIKey=OTIKRXAYHNUNSB-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
