* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-PIPERIDIN-1-YLACRIDINE |
English Synonyms: | 9-PIPERIDIN-1-YLACRIDINE |
MDL Number.: | MFCD00415939 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | N1(CCCCC1)C=1C2=CC=CC=C2N=C2C=CC=CC12 |
InChi: | InChI=1S/C18H18N2/c1-6-12-20(13-7-1)18-14-8-2-4-10-16(14)19-17-11-5-3-9-15(17)18/h2-5,8-11H,1,6-7,12-13H2 |
InChiKey: | InChIKey=CSFQDIUNXOYVAG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.