* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 18510018 |
| English Synonyms: | EMOLECULES 18510018 |
| MDL Number.: | MFCD00427125 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1ccc(cc1)/N=N/c2c3ccccc3ccc2O |
| InChi: | InChI=1S/C17H14N2O/c1-12-6-9-14(10-7-12)18-19-17-15-5-3-2-4-13(15)8-11-16(17)20/h2-11,20H,1H3/b19-18+ |
| InChiKey: | InChIKey=JCZUIEHTNMQCRK-VHEBQXMUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.