* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-BENZYL-8-CHLORO-3-METHYL-1H-PURINE-2,6(3H,7H)-DIONE |
English Synonyms: | 7-BENZYL-8-CHLORO-3-METHYL-1H-PURINE-2,6(3H,7H)-DIONE |
MDL Number.: | MFCD00428275 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cn1c2c(c(=O)[nH]c1=O)n(c(n2)Cl)Cc3ccccc3 |
InChi: | InChI=1S/C13H11ClN4O2/c1-17-10-9(11(19)16-13(17)20)18(12(14)15-10)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,16,19,20) |
InChiKey: | InChIKey=LCOWIMHMOWUCCU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.