* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 802614 |
English Synonyms: | EMOLECULES 802614 ; ZERENEX E/6026544 |
MDL Number.: | MFCD00430181 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | c1cc(oc1/C=N/NC(=O)c2ccncc2)[N+](=O)[O-] |
InChi: | InChI=1S/C11H8N4O4/c16-11(8-3-5-12-6-4-8)14-13-7-9-1-2-10(19-9)15(17)18/h1-7H,(H,14,16)/b13-7+ |
InChiKey: | InChIKey=VUUFBVKBJGFAJS-NTUHNPAUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.