* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-BROMO-5-PHENYL-1,3-DIHYDRO-BENZO[E][1,4]DIAZEPIN-2-ONE |
CAS: | 2894-61-3 |
English Synonyms: | 7-BROMO-5-PHENYL-1,3-DIHYDRO-BENZO[E][1,4]DIAZEPIN-2-ONE |
MDL Number.: | MFCD00433892 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)C2=NCC(=O)Nc3c2cc(cc3)Br |
InChi: | InChI=1S/C15H11BrN2O/c16-11-6-7-13-12(8-11)15(17-9-14(19)18-13)10-4-2-1-3-5-10/h1-8H,9H2,(H,18,19) |
InChiKey: | InChIKey=ATCCWKYKHCKDGT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.