* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB023775 |
English Synonyms: | VITAS-BB TBB023775 |
MDL Number.: | MFCD00438131 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | COC1=CC=C(C=C1)S(=O)(=O)OCC(F)(F)[N+]([O-])=O |
InChi: | InChI=1S/C9H9F2NO6S/c1-17-7-2-4-8(5-3-7)19(15,16)18-6-9(10,11)12(13)14/h2-5H,6H2,1H3 |
InChiKey: | InChIKey=QSKBHVVGXVFFJV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.