* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZX-CF011199 |
English Synonyms: | ZERENEX ZX-CF011199 |
MDL Number.: | MFCD00438780 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | COc1ccc(cc1OC)C2N[C@@H](CS2)C(=O)O |
InChi: | InChI=1S/C12H15NO4S/c1-16-9-4-3-7(5-10(9)17-2)11-13-8(6-18-11)12(14)15/h3-5,8,11,13H,6H2,1-2H3,(H,14,15)/t8-,11?/m0/s1 |
InChiKey: | InChIKey=VVYKDOVBUSRSCZ-YMNIQAILSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.