Molecular Structure:
CCD No.:CCD00130671
RCL L261807
Formula:C14 H12 N2 O2
MolWeight:240.261
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | RCL L261807 |
| English Synonyms： | RCL L261807 |
| MDL Number.： | MFCD00441421 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | c1cc(cnc1)N2C(=O)C3C4CC(C3C2=O)C=C4 |
| InChi： | InChI=1S/C14H12N2O2/c17-13-11-8-3-4-9(6-8)12(11)14(18)16(13)10-2-1-5-15-7-10/h1-5,7-9,11-12H,6H2 |
| InChiKey： | InChIKey=FRJLMKLXPWNZOS-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
