* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 4775000 |
English Synonyms: | EMOLECULES 4775000 |
MDL Number.: | MFCD00441469 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | CC1CC(=CCC1(CO)CO)CCC=C(C)C |
InChi: | InChI=1S/C15H26O2/c1-12(2)5-4-6-14-7-8-15(10-16,11-17)13(3)9-14/h5,7,13,16-17H,4,6,8-11H2,1-3H3 |
InChiKey: | InChIKey=YRUGEWVTANIGAS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.