* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-AMINO-3,4-DIHYDROACRIDIN-1(2H)-ONE |
CAS: | 104675-26-5 |
English Synonyms: | 9-AMINO-3,4-DIHYDRO-1(2H)-ACRIDINONE ; 9-AMINO-3,4-DIHYDROACRIDIN-1(2H)-ONE |
MDL Number.: | MFCD00449535 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c(c3c(n2)CCCC3=O)N |
InChi: | InChI=1S/C13H12N2O/c14-13-8-4-1-2-5-9(8)15-10-6-3-7-11(16)12(10)13/h1-2,4-5H,3,6-7H2,(H2,14,15) |
InChiKey: | InChIKey=JUSJJSHTMCPMOX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.