* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-IODOANTHRACENE |
CAS: | 22362-86-3 |
English Synonyms: | 9-IODOANTHRACENE |
MDL Number.: | MFCD00453344 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)cc3ccccc3c2I |
InChi: | InChI=1S/C14H9I/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
InChiKey: | InChIKey=IVXUUUHEJQHRMP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.