Molecular Structure:
CCD No.:CCD00132615
ZERENEX E/4045100
Formula:C12 H16 N2 S
MolWeight:220.338
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/4045100 |
| English Synonyms： | ZERENEX E/4045100 |
| MDL Number.： | MFCD00453748 |
| H bond acceptor： | 2 |
| H bond donor： | 2 |
| Smile： | Cc1cccc(c1NC(=S)NCC=C)C |
| InChi： | InChI=1S/C12H16N2S/c1-4-8-13-12(15)14-11-9(2)6-5-7-10(11)3/h4-7H,1,8H2,2-3H3,(H2,13,14,15) |
| InChiKey： | InChIKey=YBCMPOZPNYWSPZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
