Molecular Structure:
CCD No.:CCD00132736
OTAVA-BB 1795299
Formula:C13 H20 N2 O
MolWeight:220.314
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1795299 |
| English Synonyms： | OTAVA-BB 1795299 |
| MDL Number.： | MFCD00454315 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | CN1CCN(CC1)CCOc2ccccc2 |
| InChi： | InChI=1S/C13H20N2O/c1-14-7-9-15(10-8-14)11-12-16-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3 |
| InChiKey： | InChIKey=XHRCTZAXSUDEMN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
