* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHOXYACRIDINE |
CAS: | 10228-90-7 |
English Synonyms: | 9-METHOXYACRIDINE |
MDL Number.: | MFCD00454919 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | COc1c2ccccc2nc3c1cccc3 |
InChi: | InChI=1S/C14H11NO/c1-16-14-10-6-2-4-8-12(10)15-13-9-5-3-7-11(13)14/h2-9H,1H3 |
InChiKey: | InChIKey=ZHBWKWDAMIJZPW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.