Molecular Structure:
CCD No.:CCD00133157
ZERENEX E/6022269
Formula:C3 H6 N4 O2
MolWeight:130.106
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6022269 |
| English Synonyms： | ZERENEX E/6022269 |
| MDL Number.： | MFCD00456531 |
| H bond acceptor： | 6 |
| H bond donor： | 3 |
| Smile： | C(Nc1c(non1)N)O |
| InChi： | InChI=1S/C3H6N4O2/c4-2-3(5-1-8)7-9-6-2/h8H,1H2,(H2,4,6)(H,5,7) |
| InChiKey： | InChIKey=WDNJXKKEVZPNGZ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
