* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/6010065 |
English Synonyms: | ZERENEX E/6010065 |
MDL Number.: | MFCD00457939 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cc1[nH]c2c(n1)ccc3c2nsn3 |
InChi: | InChI=1S/C8H6N4S/c1-4-9-5-2-3-6-8(7(5)10-4)12-13-11-6/h2-3H,1H3,(H,9,10) |
InChiKey: | InChIKey=UPJXPKBDSWPUKT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.