Molecular Structure:
CCD No.:CCD00133543
ZERENEX E/6010065
Formula:C8 H6 N4 S
MolWeight:190.229
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6010065 |
| English Synonyms： | ZERENEX E/6010065 |
| MDL Number.： | MFCD00457939 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | Cc1[nH]c2c(n1)ccc3c2nsn3 |
| InChi： | InChI=1S/C8H6N4S/c1-4-9-5-2-3-6-8(7(5)10-4)12-13-11-6/h2-3H,1H3,(H,9,10) |
| InChiKey： | InChIKey=UPJXPKBDSWPUKT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
