* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZX-CF011194 |
English Synonyms: | ZERENEX ZX-CF011194 |
MDL Number.: | MFCD00460794 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1cc(cnc1)C2N[C@@H](CS2)C(=O)O |
InChi: | InChI=1S/C9H10N2O2S/c12-9(13)7-5-14-8(11-7)6-2-1-3-10-4-6/h1-4,7-8,11H,5H2,(H,12,13)/t7-,8?/m0/s1 |
InChiKey: | InChIKey=FSNGLHIMQHWTNF-JAMMHHFISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.