Molecular Structure:
CCD No.:CCD00134808
ZERENEX E/6028428
Formula:C11 H16 Cl N . Cl H
MolWeight:234.168
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6028428 |
| English Synonyms： | ZERENEX E/6028428 |
| MDL Number.： | MFCD00463573 |
| H bond acceptor： | 1 |
| H bond donor： | 1 |
| Smile： | CC(C)(C)NCc1ccc(cc1)Cl.Cl |
| InChi： | InChI=1S/C11H16ClN.ClH/c1-11(2,3)13-8-9-4-6-10(12)7-5-9;/h4-7,13H,8H2,1-3H3;1H |
| InChiKey： | InChIKey=AOUPMCFHBTUSMM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
