* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB007726 |
English Synonyms: | VITAS-BB TBB007726 |
MDL Number.: | MFCD00464009 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | NNC(=O)C1=C(C=NN1)[N+]([O-])=O |
InChi: | InChI=1S/C4H5N5O3/c5-7-4(10)3-2(9(11)12)1-6-8-3/h1H,5H2,(H,6,8)(H,7,10) |
InChiKey: | InChIKey=JJQIXMHAWQODPK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.