* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-METHYL-4H,5H,8H-[1,2,5]OXADIAZOLO[3,4-B][1,4]DIAZEPIN-5-ONE |
English Synonyms: | 7-METHYL-4H,5H,8H-[1,2,5]OXADIAZOLO[3,4-B][1,4]DIAZEPIN-5-ONE ; 7-METHYL-4H,8H-1,2,5-OXADIAZOLO[3,4-B]1,4-DIAZEPIN-5-ONE ; 7-METHYL-4H-[1,2,5]OXADIAZOLO[3,4-B][1,4]DIAZEPIN-5(8H)-ONE |
MDL Number.: | MFCD00465028 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC1=CC(=O)Nc2c(non2)N1 |
InChi: | InChI=1S/C6H6N4O2/c1-3-2-4(11)8-6-5(7-3)9-12-10-6/h2H,1H3,(H,7,9)(H,8,10,11) |
InChiKey: | InChIKey=QBABPLHQURZLIX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.