* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB015160 |
| English Synonyms: | VITAS-BB TBB015160 |
| MDL Number.: | MFCD00465074 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | OC1CC(O)C(O)CO1 |
| InChi: | InChI=1S/C5H10O4/c6-3-1-5(8)9-2-4(3)7/h3-8H,1-2H2 |
| InChiKey: | InChIKey=ZVQAVWAHRUNNPG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.