* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VERATRAMINE |
| CAS: | 60-70-8 |
| English Synonyms: | VERATRAMINE ; (3B,23B)-14,15,16,17-TETRADEHYDROVERATRAMAN-3,23-DIOL ; (3BETA,23BETA)-14,15,16,17-TERADEHYDROVERATRAMAN-3,23-DIOL |
| MDL Number.: | MFCD00468124 |
| H bond acceptor: | 3 |
| H bond donor: | 3 |
| Smile: | Cc1c(ccc2c1C[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O)C)[C@H](C)[C@H]5[C@@H](C[C@@H](CN5)C)O |
| InChi: | InChI=1S/C27H39NO2/c1-15-11-25(30)26(28-14-15)17(3)20-7-8-21-22-6-5-18-12-19(29)9-10-27(18,4)24(22)13-23(21)16(20)2/h5,7-8,15,17,19,22,24-26,28-30H,6,9-14H2,1-4H3/t15-,17-,19-,22-,24-,25+,26-,27-/m0/s1 |
| InChiKey: | InChIKey=MALFODICFSIXPO-KFKQDBFTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.