Molecular Structure:
CCD No.:CCD00136462
ZERENEX E/6022374
Formula:C15 H9 Cl F N O S
MolWeight:305.759
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6022374 |
| English Synonyms： | ZERENEX E/6022374 |
| MDL Number.： | MFCD00469122 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1ccc2c(c1)c(c(s2)C(=O)Nc3ccccc3F)Cl |
| InChi： | InChI=1S/C15H9ClFNOS/c16-13-9-5-1-4-8-12(9)20-14(13)15(19)18-11-7-3-2-6-10(11)17/h1-8H,(H,18,19) |
| InChiKey： | InChIKey=DDDNOQPQMGMAKQ-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
