* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7,7-DIMETHYL-3,5,7,8-TETRAHYDRO-4H-PYRIMIDO[4,5-B][1,4]BENZOTHIAZINE-4,9(6H)-DIONE |
| English Synonyms: | 7,7-DIMETHYL-3,5,7,8-TETRAHYDRO-4H-PYRIMIDO[4,5-B][1,4]BENZOTHIAZINE-4,9(6H)-DIONE |
| MDL Number.: | MFCD00473305 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC1(CC2=C(C(=O)C1)Sc3c(c(=O)[nH]cn3)N2)C |
| InChi: | InChI=1S/C12H13N3O2S/c1-12(2)3-6-9(7(16)4-12)18-11-8(15-6)10(17)13-5-14-11/h5,15H,3-4H2,1-2H3,(H,13,14,17) |
| InChiKey: | InChIKey=XMHLDQXKAQGZCA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.