* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GERANYL CINNAMATE |
| English Synonyms: | GERANYL CINNAMATE |
| MDL Number.: | MFCD00474081 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(=CCC/C(=C/COC(=O)/C=C/c1ccccc1)/C)C |
| InChi: | InChI=1S/C19H24O2/c1-16(2)8-7-9-17(3)14-15-21-19(20)13-12-18-10-5-4-6-11-18/h4-6,8,10-14H,7,9,15H2,1-3H3/b13-12+,17-14+ |
| InChiKey: | InChIKey=JCWXWRIQSPDSKY-MIFVOYFBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.