* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB017113 |
English Synonyms: | VITAS-BB TBB017113 |
MDL Number.: | MFCD00494298 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)OC1=CC=C(\C=N\NC(=O)C2=CN=CC=C2)C=C1 |
InChi: | InChI=1S/C16H17N3O2/c1-12(2)21-15-7-5-13(6-8-15)10-18-19-16(20)14-4-3-9-17-11-14/h3-12H,1-2H3,(H,19,20)/b18-10+ |
InChiKey: | InChIKey=QDOQQMJEMDEMSC-VCHYOVAHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.