* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZX-IP012217 |
English Synonyms: | ZERENEX ZX-IP012217 |
MDL Number.: | MFCD00499089 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc(c(c1)CC(=O)c2ccc(cc2O)O)F |
InChi: | InChI=1S/C14H11FO3/c15-12-4-2-1-3-9(12)7-13(17)11-6-5-10(16)8-14(11)18/h1-6,8,16,18H,7H2 |
InChiKey: | InChIKey=MOSGILKWCKIFKC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.