Molecular Structure:
CCD No.:CCD00139161
RCL L204919
Formula:C17 H14 Cl N O2
MolWeight:299.756
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | RCL L204919 |
| English Synonyms： | RCL L204919 |
| MDL Number.： | MFCD00511702 |
| H bond acceptor： | 3 |
| H bond donor： | 0 |
| Smile： | c1cc(ccc1N2C(=O)C3C4C=CC(C3C2=O)C5C4C5)Cl |
| InChi： | InChI=1S/C17H14ClNO2/c18-8-1-3-9(4-2-8)19-16(20)14-10-5-6-11(13-7-12(10)13)15(14)17(19)21/h1-6,10-15H,7H2 |
| InChiKey： | InChIKey=PRRIKTGPPBAHAR-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
