* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX000583 |
| English Synonyms: | ZERENEX ZX000583 |
| MDL Number.: | MFCD00518451 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(=O)\C=C\C1=CC=CC=C1O |
| InChi: | InChI=1S/C36H52O3/c1-24(2)9-8-10-25(3)30-16-17-31-29-15-14-27-23-28(19-21-35(27,4)32(29)20-22-36(30,31)5)39-34(38)18-13-26-11-6-7-12-33(26)37/h6-7,11-14,18,24-25,28-32,37H,8-10,15-17,19-23H2,1-5H3/b18-13+ |
| InChiKey: | InChIKey=JPTUJXPTFCNGAF-QGOAFFKASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.