* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX000584 |
| English Synonyms: | ZERENEX ZX000584 |
| MDL Number.: | MFCD00518453 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(=O)\C=C\C=C\C1=CC=CC=C1 |
| InChi: | InChI=1S/C38H54O2/c1-27(2)12-11-13-28(3)33-20-21-34-32-19-18-30-26-31(22-24-37(30,4)35(32)23-25-38(33,34)5)40-36(39)17-10-9-16-29-14-7-6-8-15-29/h6-10,14-18,27-28,31-35H,11-13,19-26H2,1-5H3/b16-9+,17-10+ |
| InChiKey: | InChIKey=ZQWQUQIGDLYSOC-CZCYGEDCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.