* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX000585 |
| English Synonyms: | ZERENEX ZX000585 |
| MDL Number.: | MFCD00518455 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CC(C)CCCC(C)C1CCC2C3CC=C4CC(CCC4(C)C3CCC12C)OC(=O)\C=C\C1=CC=C(C=C1)N(C)C |
| InChi: | InChI=1S/C38H57NO2/c1-26(2)9-8-10-27(3)33-18-19-34-32-17-14-29-25-31(21-23-37(29,4)35(32)22-24-38(33,34)5)41-36(40)20-13-28-11-15-30(16-12-28)39(6)7/h11-16,20,26-27,31-35H,8-10,17-19,21-25H2,1-7H3/b20-13+ |
| InChiKey: | InChIKey=YXNMFNAUZMYQMA-DEDYPNTBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.