* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-IP004746 |
| English Synonyms: | ZERENEX ZX-IP004746 |
| MDL Number.: | MFCD00519596 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)C(=O)O[C@@H]2CS(=O)(=O)C[C@H]2OC(=O)c3ccccc3 |
| InChi: | InChI=1S/C18H16O6S/c19-17(13-7-3-1-4-8-13)23-15-11-25(21,22)12-16(15)24-18(20)14-9-5-2-6-10-14/h1-10,15-16H,11-12H2/t15-,16-/m1/s1 |
| InChiKey: | InChIKey=NZBKYQUZFSDQDZ-HZPDHXFCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.