* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZX-IP004459 |
English Synonyms: | ZERENEX ZX-IP004459 |
MDL Number.: | MFCD00519637 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | C1[C@H]([C@@H](CS1(=O)=O)Cl)NC(=O)C(Cl)(Cl)Cl |
InChi: | InChI=1S/C6H7Cl4NO3S/c7-3-1-15(13,14)2-4(3)11-5(12)6(8,9)10/h3-4H,1-2H2,(H,11,12)/t3-,4-/m1/s1 |
InChiKey: | InChIKey=IRCRGVHTYRYWMH-QWWZWVQMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.