* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL 4-OXONONANOATE |
CAS: | 37174-92-8 |
English Synonyms: | ETHYL 4-OXONONANOATE |
MDL Number.: | MFCD00520680 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCCCCC(=O)CCC(=O)OCC |
InChi: | InChI=1S/C11H20O3/c1-3-5-6-7-10(12)8-9-11(13)14-4-2/h3-9H2,1-2H3 |
InChiKey: | InChIKey=RHHOUINGCOVIBN-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.