* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZX001063 |
English Synonyms: | ZERENEX ZX001063 |
MDL Number.: | MFCD00522181 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | [Cl-].CCCCCCCCCCOC(=O)C[N+](C)(C)CCC(C)O |
InChi: | InChI=1S/C18H38NO3.ClH/c1-5-6-7-8-9-10-11-12-15-22-18(21)16-19(3,4)14-13-17(2)20;/h17,20H,5-16H2,1-4H3;1H/q+1;/p-1 |
InChiKey: | InChIKey=HKPOGWGANHKXJO-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.