* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX000175 |
| English Synonyms: | ZERENEX ZX000175 |
| MDL Number.: | MFCD00522387 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | COC1=CC=C(\C=C2/SC(=S)N(CCCC(=O)NNC(=O)C3=CC=CC=C3O)C2=O)C=C1 |
| InChi: | InChI=1S/C22H21N3O5S2/c1-30-15-10-8-14(9-11-15)13-18-21(29)25(22(31)32-18)12-4-7-19(27)23-24-20(28)16-5-2-3-6-17(16)26/h2-3,5-6,8-11,13,26H,4,7,12H2,1H3,(H,23,27)(H,24,28)/b18-13- |
| InChiKey: | InChIKey=NPWDYMIFMREHLR-AQTBWJFISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.