* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-AB001383 |
| English Synonyms: | ZERENEX ZX-AB001383 |
| MDL Number.: | MFCD00523041 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC\1(c2ccccc2N(/C1=C\C=N\c3ccc(cc3)C(=O)O)C)C |
| InChi: | InChI=1S/C20H20N2O2/c1-20(2)16-6-4-5-7-17(16)22(3)18(20)12-13-21-15-10-8-14(9-11-15)19(23)24/h4-13H,1-3H3,(H,23,24)/b18-12-,21-13+ |
| InChiKey: | InChIKey=KGGNWESWHZLPMI-LBBNCXDASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.