* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB015952 |
English Synonyms: | VITAS-BB TBB015952 |
MDL Number.: | MFCD00540303 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC1=CC(C)=C(\C=C(/C#N)C(N)=O)C(C)=C1CC1=C(C)C=C(C)C(\C=C(\C#N)C(N)=O)=C1C |
InChi: | InChI=1S/C27H28N4O2/c1-14-7-16(3)24(18(5)22(14)9-20(12-28)26(30)32)11-25-17(4)8-15(2)23(19(25)6)10-21(13-29)27(31)33/h7-10H,11H2,1-6H3,(H2,30,32)(H2,31,33)/b20-9-,21-10+ |
InChiKey: | InChIKey=GIXUONMLBYSULL-QWHWCFICSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.