* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB000597 |
| English Synonyms: | VITAS-BB TBB000597 |
| MDL Number.: | MFCD00543149 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | COC(C(=O)NC1=CC=C(CC2=CC=C(NC(=O)C(OC)C3=CC=CC=C3)C=C2)C=C1)C1=CC=CC=C1 |
| InChi: | InChI=1S/C31H30N2O4/c1-36-28(24-9-5-3-6-10-24)30(34)32-26-17-13-22(14-18-26)21-23-15-19-27(20-16-23)33-31(35)29(37-2)25-11-7-4-8-12-25/h3-20,28-29H,21H2,1-2H3,(H,32,34)(H,33,35) |
| InChiKey: | InChIKey=WUJOJBBSXSSJRK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.