* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/6026449 |
English Synonyms: | ZERENEX E/6026449 |
MDL Number.: | MFCD00544246 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | c1ccc2c(c1)c3c([nH]2)C(NC(C3)C(=O)O)c4cc(ccc4O)[N+](=O)[O-] |
InChi: | InChI=1S/C18H15N3O5/c22-15-6-5-9(21(25)26)7-12(15)17-16-11(8-14(20-17)18(23)24)10-3-1-2-4-13(10)19-16/h1-7,14,17,19-20,22H,8H2,(H,23,24) |
InChiKey: | InChIKey=NSDWXCZFGBHFQY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.