* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/4039360 |
English Synonyms: | ZERENEX E/4039360 |
MDL Number.: | MFCD00544849 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cc2c(c3c1nc(c(n3)O)O)nsn2 |
InChi: | InChI=1S/C8H4N4O2S/c13-7-8(14)10-5-3(9-7)1-2-4-6(5)12-15-11-4/h1-2H,(H,9,13)(H,10,14) |
InChiKey: | InChIKey=LBHJHPKAXIICGU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.