Molecular Structure:
CCD No.:CCD00140604
ZERENEX E/4039360
Formula:C8 H4 N4 O2 S
MolWeight:220.212
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/4039360 |
| English Synonyms： | ZERENEX E/4039360 |
| MDL Number.： | MFCD00544849 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | c1cc2c(c3c1nc(c(n3)O)O)nsn2 |
| InChi： | InChI=1S/C8H4N4O2S/c13-7-8(14)10-5-3(9-7)1-2-4-6(5)12-15-11-4/h1-2H,(H,9,13)(H,10,14) |
| InChiKey： | InChIKey=LBHJHPKAXIICGU-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
