Molecular Structure:
CCD No.:CCD00140607
ZERENEX E/6022383
Formula:C15 H8 Br Cl N2 O3 S
MolWeight:411.662
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6022383 |
| English Synonyms： | ZERENEX E/6022383 |
| MDL Number.： | MFCD00544868 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | c1ccc2c(c1)c(c(s2)C(=O)Nc3ccc(cc3[N+](=O)[O-])Br)Cl |
| InChi： | InChI=1S/C15H8BrClN2O3S/c16-8-5-6-10(11(7-8)19(21)22)18-15(20)14-13(17)9-3-1-2-4-12(9)23-14/h1-7H,(H,18,20) |
| InChiKey： | InChIKey=QHVLMKWGGTZODH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
