Molecular Structure:
CCD No.:CCD00140661
ZERENEX E/1120033
Formula:C10 H14 Cl N3 O2 . Cl H
MolWeight:280.154
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/1120033 |
| English Synonyms： | ZERENEX E/1120033 |
| MDL Number.： | MFCD00545937 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CCNCCNc1ccc(cc1Cl)[N+](=O)[O-].Cl |
| InChi： | InChI=1S/C10H14ClN3O2.ClH/c1-2-12-5-6-13-10-4-3-8(14(15)16)7-9(10)11;/h3-4,7,12-13H,2,5-6H2,1H3;1H |
| InChiKey： | InChIKey=ZJYRWMGHIFSQHG-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
