* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/1120034 |
English Synonyms: | ZERENEX E/1120034 |
MDL Number.: | MFCD00545938 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCNCCNc1ccc(cc1[N+](=O)[O-])Cl.Cl |
InChi: | InChI=1S/C10H14ClN3O2.ClH/c1-2-12-5-6-13-9-4-3-8(11)7-10(9)14(15)16;/h3-4,7,12-13H,2,5-6H2,1H3;1H |
InChiKey: | InChIKey=KQAHJUHCWBSUBN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.