* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX E/1120089 |
| English Synonyms: | ZERENEX E/1120089 |
| MDL Number.: | MFCD00545978 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | c1ccc(c(c1)N2CCN(CC2)CCO)[N+](=O)[O-].Cl |
| InChi: | InChI=1S/C12H17N3O3.ClH/c16-10-9-13-5-7-14(8-6-13)11-3-1-2-4-12(11)15(17)18;/h1-4,16H,5-10H2;1H |
| InChiKey: | InChIKey=KKVVFIJGKNCSLG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.