* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H-THIOXANTHEN-9-OL |
CAS: | 6783-74-0 |
English Synonyms: | 9H-THIOXANTHEN-9-OL |
MDL Number.: | MFCD00551031 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)C(c3ccccc3S2)O |
InChi: | InChI=1S/C13H10OS/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,13-14H |
InChiKey: | InChIKey=IWNPWQRBFNOGHM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.