* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZX000057 |
English Synonyms: | ZERENEX ZX000057 |
MDL Number.: | MFCD00562672 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cl.CC(C)C1=CC=C(C)C=C1OCC(O)CN1CCC(C)CC1 |
InChi: | InChI=1S/C19H31NO2.ClH/c1-14(2)18-6-5-16(4)11-19(18)22-13-17(21)12-20-9-7-15(3)8-10-20;/h5-6,11,14-15,17,21H,7-10,12-13H2,1-4H3;1H |
InChiKey: | InChIKey=SLVCBUCTRGRYDV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.