* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZX000084 |
English Synonyms: | ZERENEX ZX000084 |
MDL Number.: | MFCD00562691 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cl.Cl.COC1=C(OC)C=C(COCC(O)CN2CCN(C)CC2)C=C1 |
InChi: | InChI=1S/C17H28N2O4.2ClH/c1-18-6-8-19(9-7-18)11-15(20)13-23-12-14-4-5-16(21-2)17(10-14)22-3;;/h4-5,10,15,20H,6-9,11-13H2,1-3H3;2*1H |
InChiKey: | InChIKey=RDCIPAJGEMSXEY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.